C16H13ClN2O3 — CID 9231447
methyl 2-[(Z)-[(3-chlorobenzoyl)hydrazinylidene]methyl]benzoate (PubChem CID 9231447) has the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. Its IUPAC name is methyl 2-[(Z)-[(3-chlorobenzoyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 2-[(Z)-[(3-chlorobenzoyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 9231447 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 2-[(Z)-[(3-chlorobenzoyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=N\NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O3/c1-22-16(21)14-8-3-2-5-12(14)10-18-19-15(20)11-6-4-7-13(17)9-11/h2-10H,1H3,(H,19,20)/b18-10- |
| InChIKey | LWULPXRPXCBOLV-ZDLGFXPLSA-N |
| XLogP | 2.89 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|