C25H25ClN2O3 — CID 5226825
3-chloro-N-[[2-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]benzamide (PubChem CID 5226825) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is 3-chloro-N-[[2-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-N-[[2-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5226825 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-chloro-N-[[2-[3-(2,6-dimethylphenoxy)propoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1cccc(C)c1OCCCOc1ccccc1C=NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H25ClN2O3/c1-18-8-5-9-19(2)24(18)31-15-7-14-30-23-13-4-3-10-21(23)17-27-28-25(29)20-11-6-12-22(26)16-20/h3-6,8-13,16-17H,7,14-15H2,1-2H3,(H,28,29) |
| InChIKey | NOJBGLHZAVGCQW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|