C16H14N2O4 — CID 134847140
methyl 2-[(E)-(phenoxycarbonylhydrazinylidene)methyl]benzoate (PubChem CID 134847140) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is methyl 2-[(E)-(phenoxycarbonylhydrazinylidene)methyl]benzoate.
| Compound Name | methyl 2-[(E)-(phenoxycarbonylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 134847140 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 2-[(E)-(phenoxycarbonylhydrazinylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccccc1/C=N/NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H14N2O4/c1-21-15(19)14-10-6-5-7-12(14)11-17-18-16(20)22-13-8-3-2-4-9-13/h2-11H,1H3,(H,18,20)/b17-11+ |
| InChIKey | XAKWWBZBSHCLAK-GZTJUZNOSA-N |
| XLogP | 2.60 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|