C12H15N3O2S — CID 9215995
methyl 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]benzoate (PubChem CID 9215995) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is methyl 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]benzoate.
| Compound Name | methyl 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 9215995 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 2-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]benzoate |
| SMILES | CCNC(=S)N/N=C\c1ccccc1C(=O)OC |
| InChI | InChI=1S/C12H15N3O2S/c1-3-13-12(18)15-14-8-9-6-4-5-7-10(9)11(16)17-2/h4-8H,3H2,1-2H3,(H2,13,15,18)/b14-8- |
| InChIKey | ZCXLADJHFHJALO-ZSOIEALJSA-N |
| XLogP | 1.29 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|