C15H13ClF3N3O — CID 9216990
3-chloro-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 9216990) has the molecular formula C15H13ClF3N3O and a molecular weight of 343.74 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 9216990 |
| Molecular Formula | C15H13ClF3N3O |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-chloro-N-[(Z)-(2-ethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCOc1ccccc1/C=N\Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H13ClF3N3O/c1-2-23-13-6-4-3-5-10(13)8-21-22-14-12(16)7-11(9-20-14)15(17,18)19/h3-9H,2H2,1H3,(H,20,22)/b21-8- |
| InChIKey | IMYOYPGYGNVBHI-WNFQYIGGSA-N |
| XLogP | 4.60 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|