C15H13ClF3N3O2 — CID 6165867
3-chloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 6165867) has the molecular formula C15H13ClF3N3O2 and a molecular weight of 359.74 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 6165867 |
| Molecular Formula | C15H13ClF3N3O2 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-chloro-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(/C=N\Nc2ncc(C(F)(F)F)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H13ClF3N3O2/c1-23-12-4-3-9(5-13(12)24-2)7-21-22-14-11(16)6-10(8-20-14)15(17,18)19/h3-8H,1-2H3,(H,20,22)/b21-7- |
| InChIKey | SYMWOTCPDBUIJE-YXSASFKJSA-N |
| XLogP | 4.22 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|