C16H15ClF3N3O2 — CID 9217023
3-chloro-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 9217023) has the molecular formula C16H15ClF3N3O2 and a molecular weight of 373.76 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 9217023 |
| Molecular Formula | C16H15ClF3N3O2 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-chloro-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2ncc(C(F)(F)F)cc2Cl)cc1OC |
| InChI | InChI=1S/C16H15ClF3N3O2/c1-9(10-4-5-13(24-2)14(6-10)25-3)22-23-15-12(17)7-11(8-21-15)16(18,19)20/h4-8H,1-3H3,(H,21,23)/b22-9- |
| InChIKey | XQXHSKNLVVOTEB-AFPJDJCSSA-N |
| XLogP | 4.61 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|