C19H16FN5O2 — CID 135517068
4-fluoro-N-[2-oxo-2-[(2E)-2-[(5-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 135517068) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-fluoro-N-[2-oxo-2-[(2E)-2-[(5-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-oxo-2-[(2E)-2-[(5-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 135517068 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-fluoro-N-[2-oxo-2-[(2E)-2-[(5-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)N/N=C/c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H16FN5O2/c20-16-8-6-14(7-9-16)19(27)21-12-17(26)24-22-10-15-11-23-25-18(15)13-4-2-1-3-5-13/h1-11H,12H2,(H,21,27)(H,23,25)(H,24,26)/b22-10+ |
| InChIKey | DBIPEDJJAYYSGB-LSHDLFTRSA-N |
| XLogP | 2.10 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|