C20H19N5O3 — CID 3895912
2-[(2-phenoxyacetyl)amino]-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide (PubChem CID 3895912) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[(2-phenoxyacetyl)amino]-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-[(2-phenoxyacetyl)amino]-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3895912 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[(2-phenoxyacetyl)amino]-N-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)NN=Cc1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C20H19N5O3/c26-18(13-21-19(27)14-28-17-9-5-2-6-10-17)24-22-11-16-12-23-25-20(16)15-7-3-1-4-8-15/h1-12H,13-14H2,(H,21,27)(H,23,25)(H,24,26) |
| InChIKey | SHSJZMZWGXXBEL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|