C20H18N4O2 — CID 159791235
N-[2-oxo-3-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propyl]benzamide (PubChem CID 159791235) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[2-oxo-3-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propyl]benzamide.
| Compound Name | N-[2-oxo-3-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propyl]benzamide |
|---|---|
| PubChem CID | 159791235 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[2-oxo-3-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propyl]benzamide |
| SMILES | O=C(C/N=C/c1cn[nH]c1-c1ccccc1)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O2/c25-18(14-22-20(26)16-9-5-2-6-10-16)13-21-11-17-12-23-24-19(17)15-7-3-1-4-8-15/h1-12H,13-14H2,(H,22,26)(H,23,24)/b21-11+ |
| InChIKey | NIOWORUKVZODLM-SRZZPIQSSA-N |
| XLogP | 2.49 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|