C15H14N6O — CID 135621577
2-methyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 135621577) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-methyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 2-methyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135621577 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-methyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)N/N=C/c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H14N6O/c1-21-13(7-8-18-21)15(22)20-17-10-12-9-16-19-14(12)11-5-3-2-4-6-11/h2-10H,1H3,(H,16,19)(H,20,22)/b17-10+ |
| InChIKey | RKWQHJLOBVPENX-LICLKQGHSA-N |
| XLogP | 1.57 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|