C20H20N4O — CID 135588723
2-methyl-3-phenyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propanamide (PubChem CID 135588723) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-methyl-3-phenyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | 2-methyl-3-phenyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135588723 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-methyl-3-phenyl-N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]propanamide |
| SMILES | CC(Cc1ccccc1)C(=O)N/N=C/c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4O/c1-15(12-16-8-4-2-5-9-16)20(25)24-22-14-18-13-21-23-19(18)17-10-6-3-7-11-17/h2-11,13-15H,12H2,1H3,(H,21,23)(H,24,25)/b22-14+ |
| InChIKey | SGGPRFPDFLQJPJ-HYARGMPZSA-N |
| XLogP | 3.41 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|