C11H11N7O2 — CID 3544962
1-nitro-2-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]guanidine (PubChem CID 3544962) has the molecular formula C11H11N7O2 and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-nitro-2-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]guanidine.
| Compound Name | 1-nitro-2-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 3544962 |
| Molecular Formula | C11H11N7O2 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-nitro-2-[(5-phenyl-1H-pyrazol-4-yl)methylideneamino]guanidine |
| SMILES | NC(=NN=Cc1cn[nH]c1-c1ccccc1)N[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N7O2/c12-11(17-18(19)20)16-14-7-9-6-13-15-10(9)8-4-2-1-3-5-8/h1-7H,(H,13,15)(H3,12,16,17) |
| InChIKey | WOODZVJASDHGLD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|