C8H7I2N5O3 — CID 135613058
2-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-nitroguanidine (PubChem CID 135613058) has the molecular formula C8H7I2N5O3 and a molecular weight of 474.98 g/mol. Its IUPAC name is 2-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-nitroguanidine.
| Compound Name | 2-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-nitroguanidine |
|---|---|
| PubChem CID | 135613058 |
| Molecular Formula | C8H7I2N5O3 |
| Molecular Weight | 474.98 g/mol |
| Exact Mass | 474.86 |
| IUPAC Name | 2-[(E)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-1-nitroguanidine |
| SMILES | NC(=N/N=C/c1cc(I)cc(I)c1O)N[N+](=O)[O-] |
| InChI | InChI=1S/C8H7I2N5O3/c9-5-1-4(7(16)6(10)2-5)3-12-13-8(11)14-15(17)18/h1-3,16H,(H3,11,13,14)/b12-3+ |
| InChIKey | NLDKKBPNFVPYSA-KGVSQERTSA-N |
| XLogP | 1.03 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.98 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|