C10H12IN5O4 — CID 135678871
2-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-1-nitroguanidine (PubChem CID 135678871) has the molecular formula C10H12IN5O4 and a molecular weight of 393.14 g/mol. Its IUPAC name is 2-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-1-nitroguanidine.
| Compound Name | 2-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-1-nitroguanidine |
|---|---|
| PubChem CID | 135678871 |
| Molecular Formula | C10H12IN5O4 |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 2-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-1-nitroguanidine |
| SMILES | CCOc1cc(/C=N/N=C(N)N[N+](=O)[O-])cc(I)c1O |
| InChI | InChI=1S/C10H12IN5O4/c1-2-20-8-4-6(3-7(11)9(8)17)5-13-14-10(12)15-16(18)19/h3-5,17H,2H2,1H3,(H3,12,14,15)/b13-5+ |
| InChIKey | YOZDJFFVYCKFCO-WLRTZDKTSA-N |
| XLogP | 0.83 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|