C14H13IN4O4 — CID 137152057
2-ethoxy-6-iodo-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol (PubChem CID 137152057) has the molecular formula C14H13IN4O4 and a molecular weight of 428.19 g/mol. Its IUPAC name is 2-ethoxy-6-iodo-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-ethoxy-6-iodo-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137152057 |
| Molecular Formula | C14H13IN4O4 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 2-ethoxy-6-iodo-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N/Nc2ccc([N+](=O)[O-])cn2)cc(I)c1O |
| InChI | InChI=1S/C14H13IN4O4/c1-2-23-12-6-9(5-11(15)14(12)20)7-17-18-13-4-3-10(8-16-13)19(21)22/h3-8,20H,2H2,1H3,(H,16,18)/b17-7+ |
| InChIKey | HPYXWISYOYUNJB-REZTVBANSA-N |
| XLogP | 3.14 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|