C16H14BrClN4O5 — CID 6262759
ethyl 2-[2-bromo-6-chloro-4-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 6262759) has the molecular formula C16H14BrClN4O5 and a molecular weight of 457.67 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-chloro-4-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-chloro-4-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6262759 |
| Molecular Formula | C16H14BrClN4O5 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | ethyl 2-[2-bromo-6-chloro-4-[(Z)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=N\Nc2ccc([N+](=O)[O-])cn2)cc1Br |
| InChI | InChI=1S/C16H14BrClN4O5/c1-2-26-15(23)9-27-16-12(17)5-10(6-13(16)18)7-20-21-14-4-3-11(8-19-14)22(24)25/h3-8H,2,9H2,1H3,(H,19,21)/b20-7- |
| InChIKey | KODMVWGBKAJPTB-SCDVKCJHSA-N |
| XLogP | 3.79 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|