C21H17BrN4O6 — CID 5143494
4-[[2-bromo-6-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 5143494) has the molecular formula C21H17BrN4O6 and a molecular weight of 501.29 g/mol. Its IUPAC name is 4-[[2-bromo-6-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 5143494 |
| Molecular Formula | C21H17BrN4O6 |
| Molecular Weight | 501.29 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 4-[[2-bromo-6-methoxy-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cn2)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H17BrN4O6/c1-31-18-9-14(10-24-25-19-7-6-16(11-23-19)26(29)30)8-17(22)20(18)32-12-13-2-4-15(5-3-13)21(27)28/h2-11H,12H2,1H3,(H,23,25)(H,27,28) |
| InChIKey | ZQTWXXRZSHKMFS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|