C19H13BrClN5O5 — CID 124556865
N-[(E)-[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine (PubChem CID 124556865) has the molecular formula C19H13BrClN5O5 and a molecular weight of 506.70 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine.
| Compound Name | N-[(E)-[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 124556865 |
| Molecular Formula | C19H13BrClN5O5 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 504.98 |
| IUPAC Name | N-[(E)-[3-bromo-5-chloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(COc2c(Cl)cc(/C=N/Nc3ccc([N+](=O)[O-])cn3)cc2Br)cc1 |
| InChI | InChI=1S/C19H13BrClN5O5/c20-16-7-13(9-23-24-18-6-5-15(10-22-18)26(29)30)8-17(21)19(16)31-11-12-1-3-14(4-2-12)25(27)28/h1-10H,11H2,(H,22,24)/b23-9+ |
| InChIKey | SEKZLBMVROCMQR-NUGSKGIGSA-N |
| XLogP | 5.34 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|