C17H16Br2N4O3S — CID 126376280
1-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea (PubChem CID 126376280) has the molecular formula C17H16Br2N4O3S and a molecular weight of 516.22 g/mol. Its IUPAC name is 1-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 126376280 |
| Molecular Formula | C17H16Br2N4O3S |
| Molecular Weight | 516.22 g/mol |
| Exact Mass | 513.93 |
| IUPAC Name | 1-[(Z)-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C17H16Br2N4O3S/c1-2-20-17(27)22-21-9-12-7-14(18)16(15(19)8-12)26-10-11-3-5-13(6-4-11)23(24)25/h3-9H,2,10H2,1H3,(H2,20,22,27)/b21-9- |
| InChIKey | FUUVMLDKCHKZLV-NKVSQWTQSA-N |
| XLogP | 4.52 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|