C25H24BrN3O6 — CID 124558998
N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide (PubChem CID 124558998) has the molecular formula C25H24BrN3O6 and a molecular weight of 542.39 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 124558998 |
| Molecular Formula | C25H24BrN3O6 |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2ccc(OC)cc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H24BrN3O6/c1-3-34-23-13-19(15-27-28-24(30)14-17-6-10-21(33-2)11-7-17)12-22(26)25(23)35-16-18-4-8-20(9-5-18)29(31)32/h4-13,15H,3,14,16H2,1-2H3,(H,28,30)/b27-15- |
| InChIKey | COKORMQCWAYRIC-DICXZTSXSA-N |
| XLogP | 5.04 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|