C19H12BrCl3N4O3 — CID 21209414
N-[(Z)-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine (PubChem CID 21209414) has the molecular formula C19H12BrCl3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 21209414 |
| Molecular Formula | C19H12BrCl3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 527.92 |
| IUPAC Name | N-[(Z)-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2cc(Cl)c(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)nc1 |
| InChI | InChI=1S/C19H12BrCl3N4O3/c20-14-5-12(8-25-26-18-4-2-13(9-24-18)27(28)29)7-17(23)19(14)30-10-11-1-3-15(21)16(22)6-11/h1-9H,10H2,(H,24,26)/b25-8- |
| InChIKey | ZTOKYZMSKYLZHZ-JAHAZDFLSA-N |
| XLogP | 6.74 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|