C17H9BrCl2F7N3O3 — CID 126041642
N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126041642) has the molecular formula C17H9BrCl2F7N3O3 and a molecular weight of 587.07 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126041642 |
| Molecular Formula | C17H9BrCl2F7N3O3 |
| Molecular Weight | 587.07 g/mol |
| Exact Mass | 584.91 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | O=[N+]([O-])c1cc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H9BrCl2F7N3O3/c18-10-3-9(6-28-29-17(26,27)15(21,22)16(23,24)25)5-13(30(31)32)14(10)33-7-8-1-2-11(19)12(20)4-8/h1-6,29H,7H2/b28-6- |
| InChIKey | PBBMNGUTKULNOS-IULVPYHESA-N |
| XLogP | 6.96 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.07 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|