C18H14BrF7N2O — CID 126046078
N-[(E)-[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126046078) has the molecular formula C18H14BrF7N2O and a molecular weight of 487.21 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126046078 |
| Molecular Formula | C18H14BrF7N2O |
| Molecular Weight | 487.21 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | Cc1ccc(COc2ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc2Br)cc1 |
| InChI | InChI=1S/C18H14BrF7N2O/c1-11-2-4-12(5-3-11)10-29-15-7-6-13(8-14(15)19)9-27-28-18(25,26)16(20,21)17(22,23)24/h2-9,28H,10H2,1H3/b27-9+ |
| InChIKey | XBMZVRGYKOKOPL-OXUBWTJQSA-N |
| XLogP | 6.05 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.21 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|