C12H7BrF7N3O — CID 126042681
2-[2-bromo-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetonitrile (PubChem CID 126042681) has the molecular formula C12H7BrF7N3O and a molecular weight of 422.10 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126042681 |
| Molecular Formula | C12H7BrF7N3O |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 2-[2-bromo-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H7BrF7N3O/c13-8-5-7(1-2-9(8)24-4-3-21)6-22-23-12(19,20)10(14,15)11(16,17)18/h1-2,5-6,23H,4H2/b22-6+ |
| InChIKey | BFACZWSEHQHCGM-GEVRCRHISA-N |
| XLogP | 4.07 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|