C13H8BrF7N2O — CID 126052336
N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126052336) has the molecular formula C13H8BrF7N2O and a molecular weight of 421.11 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126052336 |
| Molecular Formula | C13H8BrF7N2O |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | N-[(Z)-(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | C#CCOc1ccc(Br)cc1/C=N\NC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8BrF7N2O/c1-2-5-24-10-4-3-9(14)6-8(10)7-22-23-13(20,21)11(15,16)12(17,18)19/h1,3-4,6-7,23H,5H2/b22-7- |
| InChIKey | JTSKGJYWGKGGQD-HOEBFWFUSA-N |
| XLogP | 4.18 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|