C14H14BrF7N2O — CID 126044979
N-[(Z)-[5-bromo-2-[(2R)-butan-2-yl]oxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126044979) has the molecular formula C14H14BrF7N2O and a molecular weight of 439.17 g/mol. Its IUPAC name is N-[(Z)-[5-bromo-2-[(2R)-butan-2-yl]oxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-[5-bromo-2-[(2R)-butan-2-yl]oxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126044979 |
| Molecular Formula | C14H14BrF7N2O |
| Molecular Weight | 439.17 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-[(Z)-[5-bromo-2-[(2R)-butan-2-yl]oxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CC[C@@H](C)Oc1ccc(Br)cc1/C=N\NC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14BrF7N2O/c1-3-8(2)25-11-5-4-10(15)6-9(11)7-23-24-14(21,22)12(16,17)13(18,19)20/h4-8,24H,3H2,1-2H3/b23-7-/t8-/m1/s1 |
| InChIKey | PESCTAZZDVWRDW-KEKNWAPVSA-N |
| XLogP | 5.34 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.17 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|