C14H13Cl2F7N2O — CID 126039627
N-[(E)-[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126039627) has the molecular formula C14H13Cl2F7N2O and a molecular weight of 429.16 g/mol. Its IUPAC name is N-[(E)-[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126039627 |
| Molecular Formula | C14H13Cl2F7N2O |
| Molecular Weight | 429.16 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | N-[(E)-[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CC[C@H](C)Oc1c(Cl)cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H13Cl2F7N2O/c1-3-7(2)26-11-9(15)4-8(5-10(11)16)6-24-25-14(22,23)12(17,18)13(19,20)21/h4-7,25H,3H2,1-2H3/b24-6+/t7-/m0/s1 |
| InChIKey | NOGNELHACRBWAQ-NXNPIOOASA-N |
| XLogP | 5.88 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.16 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|