C15H16ClF7N2O2 — CID 126036197
N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126036197) has the molecular formula C15H16ClF7N2O2 and a molecular weight of 424.74 g/mol. Its IUPAC name is N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126036197 |
| Molecular Formula | C15H16ClF7N2O2 |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CC[C@@H](C)Oc1c(Cl)cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C15H16ClF7N2O2/c1-4-8(2)27-12-10(16)5-9(6-11(12)26-3)7-24-25-15(22,23)13(17,18)14(19,20)21/h5-8,25H,4H2,1-3H3/b24-7+/t8-/m1/s1 |
| InChIKey | AZMBTWZZIORCPX-BUAGIIGSSA-N |
| XLogP | 5.24 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|