C19H14ClF7N2O4 — CID 126049679
4-[[2-chloro-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126049679) has the molecular formula C19H14ClF7N2O4 and a molecular weight of 502.77 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126049679 |
| Molecular Formula | C19H14ClF7N2O4 |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 4-[[2-chloro-4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H14ClF7N2O4/c1-32-14-7-11(8-28-29-19(26,27)17(21,22)18(23,24)25)6-13(20)15(14)33-9-10-2-4-12(5-3-10)16(30)31/h2-8,29H,9H2,1H3,(H,30,31)/b28-8+ |
| InChIKey | YOYHPCWSUPWCRX-YLKCYHHESA-N |
| XLogP | 5.34 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|