C13H13F7N2O — CID 126045816
1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(3-propan-2-yloxyphenyl)methylideneamino]propan-1-amine (PubChem CID 126045816) has the molecular formula C13H13F7N2O and a molecular weight of 346.25 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(3-propan-2-yloxyphenyl)methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(3-propan-2-yloxyphenyl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126045816 |
| Molecular Formula | C13H13F7N2O |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(3-propan-2-yloxyphenyl)methylideneamino]propan-1-amine |
| SMILES | CC(C)Oc1cccc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F7N2O/c1-8(2)23-10-5-3-4-9(6-10)7-21-22-13(19,20)11(14,15)12(16,17)18/h3-8,22H,1-2H3/b21-7- |
| InChIKey | QSQDLKQNAWVDIN-YXSASFKJSA-N |
| XLogP | 4.19 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|