C13H9Br2F7N2O — CID 126049723
N-[(Z)-(3,5-dibromo-2-prop-2-enoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126049723) has the molecular formula C13H9Br2F7N2O and a molecular weight of 502.02 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2-prop-2-enoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-(3,5-dibromo-2-prop-2-enoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126049723 |
| Molecular Formula | C13H9Br2F7N2O |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 499.90 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2-prop-2-enoxyphenyl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | C=CCOc1c(Br)cc(Br)cc1/C=N\NC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9Br2F7N2O/c1-2-3-25-10-7(4-8(14)5-9(10)15)6-23-24-13(21,22)11(16,17)12(18,19)20/h2,4-6,24H,1,3H2/b23-6- |
| InChIKey | DTJYQUQDTIFZLY-OUBWWKSTSA-N |
| XLogP | 5.49 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|