C16H13F7N2O — CID 126042047
N-[(E)-(4-ethoxynaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126042047) has the molecular formula C16H13F7N2O and a molecular weight of 382.28 g/mol. Its IUPAC name is N-[(E)-(4-ethoxynaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-(4-ethoxynaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126042047 |
| Molecular Formula | C16H13F7N2O |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(E)-(4-ethoxynaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CCOc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H13F7N2O/c1-2-26-13-8-7-10(11-5-3-4-6-12(11)13)9-24-25-16(22,23)14(17,18)15(19,20)21/h3-9,25H,2H2,1H3/b24-9+ |
| InChIKey | QJZBJSMUZMMNML-PGGKNCGUSA-N |
| XLogP | 4.95 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|