C16H10F10N2S — CID 126048643
1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-(2,2,2-trifluoroethylsulfanyl)naphthalen-1-yl]methylideneamino]propan-1-amine (PubChem CID 126048643) has the molecular formula C16H10F10N2S and a molecular weight of 452.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-(2,2,2-trifluoroethylsulfanyl)naphthalen-1-yl]methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-(2,2,2-trifluoroethylsulfanyl)naphthalen-1-yl]methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126048643 |
| Molecular Formula | C16H10F10N2S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-(2,2,2-trifluoroethylsulfanyl)naphthalen-1-yl]methylideneamino]propan-1-amine |
| SMILES | FC(F)(F)CSc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C16H10F10N2S/c17-13(18,19)8-29-12-6-5-9(10-3-1-2-4-11(10)12)7-27-28-16(25,26)14(20,21)15(22,23)24/h1-7,28H,8H2/b27-7+ |
| InChIKey | BWBQRAGQOIDSQZ-OAHLVZFQSA-N |
| XLogP | 6.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|