C21H15F7N2S — CID 126055356
N-[(E)-(4-benzylsulfanylnaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126055356) has the molecular formula C21H15F7N2S and a molecular weight of 460.42 g/mol. Its IUPAC name is N-[(E)-(4-benzylsulfanylnaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-(4-benzylsulfanylnaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126055356 |
| Molecular Formula | C21H15F7N2S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-[(E)-(4-benzylsulfanylnaphthalen-1-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1ccc(SCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H15F7N2S/c22-19(23,20(24,25)26)21(27,28)30-29-12-15-10-11-18(17-9-5-4-8-16(15)17)31-13-14-6-2-1-3-7-14/h1-12,30H,13H2/b29-12+ |
| InChIKey | XTHWFGLYOITSJB-XKJRVUDJSA-N |
| XLogP | 6.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|