C11H7F7N2O2 — CID 126042822
4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]benzoic acid (PubChem CID 126042822) has the molecular formula C11H7F7N2O2 and a molecular weight of 332.18 g/mol. Its IUPAC name is 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]benzoic acid.
| Compound Name | 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 126042822 |
| Molecular Formula | C11H7F7N2O2 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F7N2O2/c12-9(13,10(14,15)16)11(17,18)20-19-5-6-1-3-7(4-2-6)8(21)22/h1-5,20H,(H,21,22)/b19-5+ |
| InChIKey | RFGXTYCPERBQIV-PTXOJBNSSA-N |
| XLogP | 3.10 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|