C15H8ClF7N2O3 — CID 126046649
2-chloro-4-[5-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 126046649) has the molecular formula C15H8ClF7N2O3 and a molecular weight of 432.68 g/mol. Its IUPAC name is 2-chloro-4-[5-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126046649 |
| Molecular Formula | C15H8ClF7N2O3 |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-chloro-4-[5-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)o2)cc1Cl |
| InChI | InChI=1S/C15H8ClF7N2O3/c16-10-5-7(1-3-9(10)12(26)27)11-4-2-8(28-11)6-24-25-15(22,23)13(17,18)14(19,20)21/h1-6,25H,(H,26,27)/b24-6+ |
| InChIKey | SPLSPQQQDCBYLI-GFXGDVFHSA-N |
| XLogP | 5.01 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|