C15H14N2O2 — CID 9014672
4-[(Z)-[(2-methylphenyl)hydrazinylidene]methyl]benzoic acid (PubChem CID 9014672) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-[(Z)-[(2-methylphenyl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[(2-methylphenyl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 9014672 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-[(Z)-[(2-methylphenyl)hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1ccccc1N/N=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H14N2O2/c1-11-4-2-3-5-14(11)17-16-10-12-6-8-13(9-7-12)15(18)19/h2-10,17H,1H3,(H,18,19)/b16-10- |
| InChIKey | MLLIWOKYHXWDFB-YBEGLDIGSA-N |
| XLogP | 3.14 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|