C16H12F3N3O2S — CID 6016961
4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]benzoic acid (PubChem CID 6016961) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6016961 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N\NC(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3N3O2S/c17-16(18,19)12-3-1-2-4-13(12)21-15(25)22-20-9-10-5-7-11(8-6-10)14(23)24/h1-9H,(H,23,24)(H2,21,22,25)/b20-9- |
| InChIKey | QLWVAJIXPAKUKV-UKWGHVSLSA-N |
| XLogP | 3.72 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|