C17H15F3N4OS — CID 7937343
N-[4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide (PubChem CID 7937343) has the molecular formula C17H15F3N4OS and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 7937343 |
| Molecular Formula | C17H15F3N4OS |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[4-[(Z)-[[2-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=N\NC(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3N4OS/c1-11(25)22-13-8-6-12(7-9-13)10-21-24-16(26)23-15-5-3-2-4-14(15)17(18,19)20/h2-10H,1H3,(H,22,25)(H2,23,24,26)/b21-10- |
| InChIKey | PJPGDGJEVHMLHQ-FBHDLOMBSA-N |
| XLogP | 3.98 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|