C23H25F3N4O4S — CID 6217554
1-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 6217554) has the molecular formula C23H25F3N4O4S and a molecular weight of 510.54 g/mol. Its IUPAC name is 1-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 6217554 |
| Molecular Formula | C23H25F3N4O4S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCOc1cc(/C=N\NC(=S)Nc2ccccc2C(F)(F)F)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H25F3N4O4S/c1-2-33-20-13-16(7-8-19(20)34-15-21(31)30-9-11-32-12-10-30)14-27-29-22(35)28-18-6-4-3-5-17(18)23(24,25)26/h3-8,13-14H,2,9-12,15H2,1H3,(H2,28,29,35)/b27-14- |
| InChIKey | LCNQEXURBMKXNL-VYYCAZPPSA-N |
| XLogP | 3.66 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|