C19H17N5OS — CID 5131994
N-[4-[(quinolin-8-ylcarbamothioylhydrazinylidene)methyl]phenyl]acetamide (PubChem CID 5131994) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[4-[(quinolin-8-ylcarbamothioylhydrazinylidene)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(quinolin-8-ylcarbamothioylhydrazinylidene)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 5131994 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[4-[(quinolin-8-ylcarbamothioylhydrazinylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=NNC(=S)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C19H17N5OS/c1-13(25)22-16-9-7-14(8-10-16)12-21-24-19(26)23-17-6-2-4-15-5-3-11-20-18(15)17/h2-12H,1H3,(H,22,25)(H2,23,24,26) |
| InChIKey | VJJAHTCQMLVBSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|