C17H13ClN4OS — CID 136766500
1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-quinolin-8-ylthiourea (PubChem CID 136766500) has the molecular formula C17H13ClN4OS and a molecular weight of 356.84 g/mol. Its IUPAC name is 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-quinolin-8-ylthiourea.
| Compound Name | 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-quinolin-8-ylthiourea |
|---|---|
| PubChem CID | 136766500 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-quinolin-8-ylthiourea |
| SMILES | Oc1ccc(Cl)cc1/C=N\NC(=S)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C17H13ClN4OS/c18-13-6-7-15(23)12(9-13)10-20-22-17(24)21-14-5-1-3-11-4-2-8-19-16(11)14/h1-10,23H,(H2,21,22,24)/b20-10- |
| InChIKey | MNJZHGWJTKDZKT-JMIUGGIZSA-N |
| XLogP | 3.91 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|