C8H7ClN2O3 — CID 135408520
[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]carbamic acid (PubChem CID 135408520) has the molecular formula C8H7ClN2O3 and a molecular weight of 214.61 g/mol. Its IUPAC name is [(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]carbamic acid.
| Compound Name | [(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]carbamic acid |
|---|---|
| PubChem CID | 135408520 |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | [(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]carbamic acid |
| SMILES | O=C(O)N/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C8H7ClN2O3/c9-6-1-2-7(12)5(3-6)4-10-11-8(13)14/h1-4,11-12H,(H,13,14)/b10-4+ |
| InChIKey | AETZGWXZIWSDGT-ONNFQVAWSA-N |
| XLogP | 1.65 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|