C21H17N5O2 — CID 108818817
(Z)-N-(4-acetamidophenyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide (PubChem CID 108818817) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is (Z)-N-(4-acetamidophenyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818817 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C21H17N5O2/c1-14(27)25-17-7-9-18(10-8-17)26-21(28)16(12-22)13-24-19-6-2-4-15-5-3-11-23-20(15)19/h2-11,13,24H,1H3,(H,25,27)(H,26,28)/b16-13- |
| InChIKey | BELPZPOKHAHYPF-SSZFMOIBSA-N |
| XLogP | 3.65 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|