C20H15ClN4O — CID 108836033
(Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide (PubChem CID 108836033) has the molecular formula C20H15ClN4O and a molecular weight of 362.82 g/mol. Its IUPAC name is (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108836033 |
| Molecular Formula | C20H15ClN4O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (Z)-N-[(2-chlorophenyl)methyl]-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc2cccnc12)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C20H15ClN4O/c21-17-8-2-1-5-15(17)12-25-20(26)16(11-22)13-24-18-9-3-6-14-7-4-10-23-19(14)18/h1-10,13,24H,12H2,(H,25,26)/b16-13- |
| InChIKey | JKCPPJLPCLLRTD-SSZFMOIBSA-N |
| XLogP | 4.02 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|