C20H24N4O2 — CID 108837152
(Z)-N-(3-butoxypropyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide (PubChem CID 108837152) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (Z)-N-(3-butoxypropyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108837152 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (Z)-N-(3-butoxypropyl)-2-cyano-3-(quinolin-8-ylamino)prop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1cccc2cccnc12 |
| InChI | InChI=1S/C20H24N4O2/c1-2-3-12-26-13-6-11-23-20(25)17(14-21)15-24-18-9-4-7-16-8-5-10-22-19(16)18/h4-5,7-10,15,24H,2-3,6,11-13H2,1H3,(H,23,25)/b17-15- |
| InChIKey | YRFFHFYQAFHOJF-ICFOKQHNSA-N |
| XLogP | 3.38 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|