C21H31N3O2 — CID 108837194
(Z)-3-(2-butan-2-ylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide (PubChem CID 108837194) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (Z)-3-(2-butan-2-ylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(2-butan-2-ylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108837194 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (Z)-3-(2-butan-2-ylanilino)-N-(3-butoxypropyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCOCCCNC(=O)/C(C#N)=C\Nc1ccccc1C(C)CC |
| InChI | InChI=1S/C21H31N3O2/c1-4-6-13-26-14-9-12-23-21(25)18(15-22)16-24-20-11-8-7-10-19(20)17(3)5-2/h7-8,10-11,16-17,24H,4-6,9,12-14H2,1-3H3,(H,23,25)/b18-16- |
| InChIKey | UWXHVEWRCKFBRU-VLGSPTGOSA-N |
| XLogP | 4.34 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|