C13H17N5O2 — CID 108834066
(Z)-2-cyano-N-(3-ethoxypropyl)-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108834066) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethoxypropyl)-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethoxypropyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108834066 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethoxypropyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | CCOCCCNC(=O)/C(C#N)=C\Nc1ncccn1 |
| InChI | InChI=1S/C13H17N5O2/c1-2-20-8-4-7-15-12(19)11(9-14)10-18-13-16-5-3-6-17-13/h3,5-6,10H,2,4,7-8H2,1H3,(H,15,19)(H,16,17,18)/b11-10- |
| InChIKey | CUGHGCCCPWDWIK-KHPPLWFESA-N |
| XLogP | 0.84 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|