C15H17Cl2N3O2 — CID 108833942
(Z)-2-cyano-3-(2,3-dichloroanilino)-N-(3-ethoxypropyl)prop-2-enamide (PubChem CID 108833942) has the molecular formula C15H17Cl2N3O2 and a molecular weight of 342.23 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,3-dichloroanilino)-N-(3-ethoxypropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,3-dichloroanilino)-N-(3-ethoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 108833942 |
| Molecular Formula | C15H17Cl2N3O2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (Z)-2-cyano-3-(2,3-dichloroanilino)-N-(3-ethoxypropyl)prop-2-enamide |
| SMILES | CCOCCCNC(=O)/C(C#N)=C\Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H17Cl2N3O2/c1-2-22-8-4-7-19-15(21)11(9-18)10-20-13-6-3-5-12(16)14(13)17/h3,5-6,10,20H,2,4,7-8H2,1H3,(H,19,21)/b11-10- |
| InChIKey | PUWFIZQWWZKNLL-KHPPLWFESA-N |
| XLogP | 3.36 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|